CAS 1106837-36-8 is the registry number for 3'-Trifluoromethylbiphenyl-4-boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-[3-(trifluoromethyl)phenyl]phenyl]boronic acid (CAS 1106837-36-8) is a chemical compound with the molecular formula C13H10BF3O2 and a molecular weight of 266.03 g/mol. IUPAC name: [4-[3-(trifluoromethyl)phenyl]phenyl]boronic acid. InChIKey: GKGSHGQGXTXEQY-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O2 |
|---|---|
| Molecular weight | 266.03 g/mol |
| IUPAC name | [4-[3-(trifluoromethyl)phenyl]phenyl]boronic acid |
| InChIKey | GKGSHGQGXTXEQY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC(=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)