CAS 1265312-61-5 is the registry number for (4'–(Trifluoromethyl)–(1,1'–biphenyl)–2–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-[4-(trifluoromethyl)phenyl]phenyl]boronic acid (CAS 1265312-61-5) is a chemical compound with the molecular formula C13H10BF3O2 and a molecular weight of 266.03 g/mol. IUPAC name: [2-[4-(trifluoromethyl)phenyl]phenyl]boronic acid. InChIKey: NQYKBFLXPKKPIA-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O2 |
|---|---|
| Molecular weight | 266.03 g/mol |
| IUPAC name | [2-[4-(trifluoromethyl)phenyl]phenyl]boronic acid |
| InChIKey | NQYKBFLXPKKPIA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=CC=C(C=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)