CAS 1200834-19-0 is the registry number for (2-(Trifluoromethyl)-[1,1'-biphenyl]-4-yl)boronic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
[4-phenyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 1200834-19-0) is a chemical compound with the molecular formula C13H10BF3O2 and a molecular weight of 266.03 g/mol. IUPAC name: [4-phenyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: NTGSESYCUXODSE-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O2 |
|---|---|
| Molecular weight | 266.03 g/mol |
| IUPAC name | [4-phenyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | NTGSESYCUXODSE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=CC=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)