CAS 364590-93-2 appears in our catalog under these names: 4'-(Trifluoromethyl)-4-biphenylboronic acid, 98%, (4-(4-Trifluoromethylphenyl)phenyl)boronic acid, 95-<97%, (4-(4-Trifluoromethylphenyl)phenyl)boronic acid, ≥97-<99%, (4'-(Trifluoromethyl)-(1,1'-biphenyl)-4-yl)boronic Acid, (4'–(Trifluoromethyl)– (1,1'–biphenyl)–4–yl)boronic acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC, GLPBio, Chemat. Available pack sizes: 250mg, 5g, 1g, 25g, 50g, 100g, 200g, 300g.
[4-[4-(trifluoromethyl)phenyl]phenyl]boronic acid (CAS 364590-93-2) is a chemical compound with the molecular formula C13H10BF3O2 and a molecular weight of 266.03 g/mol. IUPAC name: [4-[4-(trifluoromethyl)phenyl]phenyl]boronic acid. InChIKey: VXRWBTTXNCRCPS-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O2 |
|---|---|
| Molecular weight | 266.03 g/mol |
| IUPAC name | [4-[4-(trifluoromethyl)phenyl]phenyl]boronic acid |
| InChIKey | VXRWBTTXNCRCPS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)