Products 1106953-35-8

CAS 1106953-35-8 is the registry number for Ethyl 3-(5-chloropyridin-2-yl)-3-oxopropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 3-(5-chloro-2-pyridinyl)-3-oxopropanoate (CAS 1106953-35-8) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: ethyl 3-(5-chloro-2-pyridinyl)-3-oxopropanoate. InChIKey: UPCXRWTVYHMKCE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO3
Molecular weight227.64 g/mol
IUPAC nameethyl 3-(5-chloro-2-pyridinyl)-3-oxopropanoate
InChIKeyUPCXRWTVYHMKCE-UHFFFAOYSA-N
SMILESCCOC(=O)CC(=O)C1=NC=C(C=C1)Cl

Computed by PubChem (NCBI)