CAS 1106953-35-8 is the registry number for Ethyl 3-(5-chloropyridin-2-yl)-3-oxopropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 3-(5-chloro-2-pyridinyl)-3-oxopropanoate (CAS 1106953-35-8) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: ethyl 3-(5-chloro-2-pyridinyl)-3-oxopropanoate. InChIKey: UPCXRWTVYHMKCE-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | ethyl 3-(5-chloro-2-pyridinyl)-3-oxopropanoate |
| InChIKey | UPCXRWTVYHMKCE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=NC=C(C=C1)Cl |
Computed by PubChem (NCBI)