CAS 110762-12-4 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)amino)-3-(p-tolyl)propanoic acid, 95%, 2–((tert–butoxycarbonyl)amino)–3–(p–tolyl)propanoic acid, 2-((tert-Butoxycarbonyl)amino)-3-(p-tolyl)propanoic acid, 97%, 97%, 2-((TERT-BUTOXYCARBONYL)AMINO)-3-(P-TOLYL)PROPANOIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
3-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 110762-12-4) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: 3-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JYRWNPUFECDJCX-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | 3-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JYRWNPUFECDJCX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)