CAS 110827-84-4 is the registry number for 2,3-Dihydroxybenzaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[(E)-hydroxyiminomethyl]benzene-1,2-diol (CAS 110827-84-4) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-[(E)-hydroxyiminomethyl]benzene-1,2-diol. InChIKey: UAICVXLIXRIZBA-XBXARRHUSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-[(E)-hydroxyiminomethyl]benzene-1,2-diol |
| InChIKey | UAICVXLIXRIZBA-XBXARRHUSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)/C=N/O |
Computed by PubChem (NCBI)