Products 110893-37-3

CAS 110893-37-3 is the registry number for Isopropyl 3-cyanobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Propan-2-yl 3-cyanobenzoate (CAS 110893-37-3) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: propan-2-yl 3-cyanobenzoate. InChIKey: YMOAZNBHBMMUSB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO2
Molecular weight189.21 g/mol
IUPAC namepropan-2-yl 3-cyanobenzoate
InChIKeyYMOAZNBHBMMUSB-UHFFFAOYSA-N
SMILESCC(C)OC(=O)C1=CC=CC(=C1)C#N

Computed by PubChem (NCBI)