CAS 110893-37-3 is the registry number for Isopropyl 3-cyanobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Propan-2-yl 3-cyanobenzoate (CAS 110893-37-3) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: propan-2-yl 3-cyanobenzoate. InChIKey: YMOAZNBHBMMUSB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | propan-2-yl 3-cyanobenzoate |
| InChIKey | YMOAZNBHBMMUSB-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=CC(=C1)C#N |
Computed by PubChem (NCBI)