Products 110901-92-3
CAS 110901-92-3 appears in our catalog under these names: trans–2–(3–methoxyphenyl)cyclopropan–1–amine hydrochloride, (1R,2S)-2-(3-Methoxyphenyl)Cyclopropan-1-Amine Hydrochloride, 99%, rac-(1R,2S)-2-(3-methoxyphenyl)cyclopropan-1-amine hydrochloride, 99%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Trans-(1R,2S)-2-(3-methoxyphenyl)cyclopropan-1-amine;hydrochloride (CAS 110901-92-3) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: trans-(1R,2S)-2-(3-methoxyphenyl)cyclopropan-1-amine;hydrochloride. InChIKey: FRZAHERUZSETAJ-BAUSSPIASA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3-methoxyphenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | FRZAHERUZSETAJ-BAUSSPIASA-N |
| SMILES | COC1=CC=CC(=C1)[C@@H]2C[C@H]2N.Cl |
Computed by PubChem (NCBI)