CAS 110933-21-6 appears in our catalog under these names: Flutriafol Impurity D, Flutriafol Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1,1-bis(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanol (CAS 110933-21-6) is a chemical compound with the molecular formula C16H13F2N3O and a molecular weight of 301.29 g/mol. IUPAC name: 1,1-bis(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanol. InChIKey: OGNWUMBPDUXFMB-UHFFFAOYSA-N.
| Molecular formula | C16H13F2N3O |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | 1,1-bis(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanol |
| InChIKey | OGNWUMBPDUXFMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CN2C=NN=C2)(C3=CC=C(C=C3)F)O)F |
Computed by PubChem (NCBI)