CAS 877969-69-2 appears in our catalog under these names: VPC-80051 racemate/ 98%, VPC–80051 racemate, VPC-80051 (racemate), ≥98%, ≥98%, VPC-80051 (racemate), 98.99%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 25 mg.
N-[(1S)-1-(3,4-difluorophenyl)ethyl]-1H-indazole-3-carboxamide (CAS 877969-69-2) is a chemical compound with the molecular formula C16H13F2N3O and a molecular weight of 301.29 g/mol. IUPAC name: N-[(1S)-1-(3,4-difluorophenyl)ethyl]-1H-indazole-3-carboxamide. InChIKey: MVHNHGGJTMFAQP-VIFPVBQESA-N.
| Molecular formula | C16H13F2N3O |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | N-[(1S)-1-(3,4-difluorophenyl)ethyl]-1H-indazole-3-carboxamide |
| InChIKey | MVHNHGGJTMFAQP-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)F)F)NC(=O)C2=NNC3=CC=CC=C32 |
Computed by PubChem (NCBI)