Products 124774-27-2

CAS 124774-27-2 appears in our catalog under these names: Flutriafol Impurity A, Flutriafol Impurity 1. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(2-fluorophenyl)-1-(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanol (CAS 124774-27-2) is a chemical compound with the molecular formula C16H13F2N3O and a molecular weight of 301.29 g/mol. IUPAC name: 1-(2-fluorophenyl)-1-(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanol. InChIKey: AVRBOWUBROGTNG-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13F2N3O
Molecular weight301.29 g/mol
IUPAC name1-(2-fluorophenyl)-1-(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanol
InChIKeyAVRBOWUBROGTNG-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(CN2C=NN=C2)(C3=CC=C(C=C3)F)O)F

Computed by PubChem (NCBI)