Products 2410979-04-1
CAS 2410979-04-1 is the registry number for VPC-80051, 99.77%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 5 mg, 10 mg, 50 mg, 25 mg, 100 mg.
N-[(1S)-1-(3,4-difluorophenyl)ethyl]-1H-indazole-3-carboxamide (CAS 2410979-04-1) is a chemical compound with the molecular formula C16H13F2N3O and a molecular weight of 301.29 g/mol. IUPAC name: N-[(1S)-1-(3,4-difluorophenyl)ethyl]-1H-indazole-3-carboxamide. InChIKey: MVHNHGGJTMFAQP-VIFPVBQESA-N.
| Molecular formula | C16H13F2N3O |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | N-[(1S)-1-(3,4-difluorophenyl)ethyl]-1H-indazole-3-carboxamide |
| InChIKey | MVHNHGGJTMFAQP-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)F)F)NC(=O)C2=NNC3=CC=CC=C32 |
Computed by PubChem (NCBI)