Products 110995-29-4

CAS 110995-29-4 is the registry number for 5-Formyl-2,4-dimethylpyrrole-3-propionic acid, methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate (CAS 110995-29-4) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate. InChIKey: ICSYWXKWNBYRGB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO3
Molecular weight209.24 g/mol
IUPAC namemethyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate
InChIKeyICSYWXKWNBYRGB-UHFFFAOYSA-N
SMILESCC1=C(NC(=C1CCC(=O)OC)C)C=O

Computed by PubChem (NCBI)