Products 111034-55-0
CAS 111034-55-0 appears in our catalog under these names: (3R,5S)-1-Methyl-2-oxo-5-(pyridin-3-yl)pyrrolidin-3-yl acetate, 97%, trans-3'-Hydroxy Cotinine Acetate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 5mg.
[(3R,5S)-1-methyl-2-oxo-5-pyridin-3-ylpyrrolidin-3-yl] acetate (CAS 111034-55-0) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: [(3R,5S)-1-methyl-2-oxo-5-pyridin-3-ylpyrrolidin-3-yl] acetate. InChIKey: ZCLBVMFGRVMSHK-WDEREUQCSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | [(3R,5S)-1-methyl-2-oxo-5-pyridin-3-ylpyrrolidin-3-yl] acetate |
| InChIKey | ZCLBVMFGRVMSHK-WDEREUQCSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@H](N(C1=O)C)C2=CN=CC=C2 |
Computed by PubChem (NCBI)