CAS 1110542-95-4 appears in our catalog under these names: 6-Chloro-3-(pyridin-2-yl)-(1,2,4)triazolo(4,3-b)pyridazine, 98%, 2-{6-Chloro-(1,2,4)triazolo(4,3-b)pyridazin-3-yl}pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-chloro-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1110542-95-4) is a chemical compound with the molecular formula C10H6ClN5 and a molecular weight of 231.64 g/mol. IUPAC name: 6-chloro-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: MVJZVTGJTQYPRW-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN5 |
|---|---|
| Molecular weight | 231.64 g/mol |
| IUPAC name | 6-chloro-3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | MVJZVTGJTQYPRW-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)