CAS 926232-96-4 is the registry number for 7-Chloro-5-(pyridin-3-yl)-[1,2,4]triazolo[1,5-a]pyrimidine, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g.
7-chloro-5-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 926232-96-4) is a chemical compound with the molecular formula C10H6ClN5 and a molecular weight of 231.64 g/mol. IUPAC name: 7-chloro-5-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: BGGWRZJJRJTKIU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN5 |
|---|---|
| Molecular weight | 231.64 g/mol |
| IUPAC name | 7-chloro-5-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | BGGWRZJJRJTKIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC3=NC=NN3C(=C2)Cl |
Computed by PubChem (NCBI)