CAS 54448-61-2 appears in our catalog under these names: 7-Chloro-3-(1H-imidazol-1-yl)benzo(e)(1,2,4)triazine, Triazoxide-desoxy. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 1mg, 25mg, 50mg.
7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine (CAS 54448-61-2) is a chemical compound with the molecular formula C10H6ClN5 and a molecular weight of 231.64 g/mol. IUPAC name: 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine. InChIKey: DGTGEGYFJGFHNA-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN5 |
|---|---|
| Molecular weight | 231.64 g/mol |
| IUPAC name | 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine |
| InChIKey | DGTGEGYFJGFHNA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=NC(=N2)N3C=CN=C3 |
Computed by PubChem (NCBI)