CAS 17466-00-1 appears in our catalog under these names: 7-Chloro-3-phenyl-3h-[1,2,3]triazolo[4,5-d]pyrimidine, 95%, 7-Chloro-3-phenyl-3H-(1,2,3)triazolo(4,5-d)pyrimidine, 97%, 7-Chloro-3-phenyl-3H-(1,2,3)triazolo(4,5-d)pyrimidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 50mg, 0,5g.
7-chloro-3-phenyltriazolo[4,5-d]pyrimidine (CAS 17466-00-1) is a chemical compound with the molecular formula C10H6ClN5 and a molecular weight of 231.64 g/mol. IUPAC name: 7-chloro-3-phenyltriazolo[4,5-d]pyrimidine. InChIKey: KVCGBXCBEHBNSH-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN5 |
|---|---|
| Molecular weight | 231.64 g/mol |
| IUPAC name | 7-chloro-3-phenyltriazolo[4,5-d]pyrimidine |
| InChIKey | KVCGBXCBEHBNSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C(=NC=N3)Cl)N=N2 |
Computed by PubChem (NCBI)