Products 111083-28-4
CAS 111083-28-4 appears in our catalog under these names: 6-Bromo-5-methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid, 6-Bromo-5-methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid, 97%. Offered by: Biosynth, Fluorochem. Available pack sizes: 5000mg, 1000mg, 1g.
6-bromo-5-methoxy-1,2-dimethylindole-3-carboxylic acid (CAS 111083-28-4) is a chemical compound with the molecular formula C12H12BrNO3 and a molecular weight of 298.13 g/mol. IUPAC name: 6-bromo-5-methoxy-1,2-dimethylindole-3-carboxylic acid. InChIKey: LTBHATYBASAESJ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO3 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 6-bromo-5-methoxy-1,2-dimethylindole-3-carboxylic acid |
| InChIKey | LTBHATYBASAESJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC(=C(C=C2N1C)Br)OC)C(=O)O |
Computed by PubChem (NCBI)