CAS 1112210-82-8 appears in our catalog under these names: 1,3–Dibromo–5–isopropoxybenzene, 1,3-Dibromo-5-isopropoxybenzene 97%, 1,3-Dibromo-5-isopropoxybenzene, 97%, 97%, 3,5-Dibromoisopropoxybenzene, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
1,3-dibromo-5-propan-2-yloxybenzene (CAS 1112210-82-8) is a chemical compound with the molecular formula C9H10Br2O and a molecular weight of 293.98 g/mol. IUPAC name: 1,3-dibromo-5-propan-2-yloxybenzene. InChIKey: YEANGEKXRPNJTL-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2O |
|---|---|
| Molecular weight | 293.98 g/mol |
| IUPAC name | 1,3-dibromo-5-propan-2-yloxybenzene |
| InChIKey | YEANGEKXRPNJTL-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)