CAS 57825-70-4 is the registry number for 2,6-Dibromo-3,4,5-trimethylphenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
2,6-dibromo-3,4,5-trimethylphenol (CAS 57825-70-4) is a chemical compound with the molecular formula C9H10Br2O and a molecular weight of 293.98 g/mol. IUPAC name: 2,6-dibromo-3,4,5-trimethylphenol. InChIKey: UIKWFTVJRRTFNL-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2O |
|---|---|
| Molecular weight | 293.98 g/mol |
| IUPAC name | 2,6-dibromo-3,4,5-trimethylphenol |
| InChIKey | UIKWFTVJRRTFNL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)Br)O)Br)C |
Computed by PubChem (NCBI)