Products 57825-70-4

CAS 57825-70-4 is the registry number for 2,6-Dibromo-3,4,5-trimethylphenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

2,6-dibromo-3,4,5-trimethylphenol (CAS 57825-70-4) is a chemical compound with the molecular formula C9H10Br2O and a molecular weight of 293.98 g/mol. IUPAC name: 2,6-dibromo-3,4,5-trimethylphenol. InChIKey: UIKWFTVJRRTFNL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10Br2O
Molecular weight293.98 g/mol
IUPAC name2,6-dibromo-3,4,5-trimethylphenol
InChIKeyUIKWFTVJRRTFNL-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=C1C)Br)O)Br)C

Computed by PubChem (NCBI)