Products 1864003-38-2

CAS 1864003-38-2 is the registry number for (+/-)-Trans-4-(2-thienyl)-pyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(3R,4R)-4-thiophen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1864003-38-2) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: (3R,4R)-4-thiophen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: GVSBLQBHDFDDJO-LEUCUCNGSA-N.

Identity
Molecular formulaC9H12ClNO2S
Molecular weight233.72 g/mol
IUPAC name(3R,4R)-4-thiophen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride
InChIKeyGVSBLQBHDFDDJO-LEUCUCNGSA-N
SMILESC1[C@@H]([C@H](CN1)C(=O)O)C2=CC=CS2.Cl

Computed by PubChem (NCBI)