CAS 1864003-38-2 is the registry number for (+/-)-Trans-4-(2-thienyl)-pyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.
(3R,4R)-4-thiophen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1864003-38-2) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: (3R,4R)-4-thiophen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: GVSBLQBHDFDDJO-LEUCUCNGSA-N.
| Molecular formula | C9H12ClNO2S |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | (3R,4R)-4-thiophen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | GVSBLQBHDFDDJO-LEUCUCNGSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC=CS2.Cl |
Computed by PubChem (NCBI)