Products 1357352-49-8
CAS 1357352-49-8 appears in our catalog under these names: 5-(Methylsulfonyl)-indoline hydrochloride, 95%, 5-(Methylsulfonyl)indoline hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 25g.
5-methylsulfonyl-2,3-dihydro-1H-indole;hydrochloride (CAS 1357352-49-8) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: 5-methylsulfonyl-2,3-dihydro-1H-indole;hydrochloride. InChIKey: NWOMFFODCVURBX-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2S |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | 5-methylsulfonyl-2,3-dihydro-1H-indole;hydrochloride |
| InChIKey | NWOMFFODCVURBX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)NCC2.Cl |
Computed by PubChem (NCBI)