CAS 1269054-05-8 appears in our catalog under these names: 5-(Pyrrolidin-2-yl)thiophene-2-carboxylic acid hydrochloride, 95%, 5-(Pyrrolidin-2-yl)thiophene-2-carboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-pyrrolidin-2-ylthiophene-2-carboxylic acid;hydrochloride (CAS 1269054-05-8) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: 5-pyrrolidin-2-ylthiophene-2-carboxylic acid;hydrochloride. InChIKey: IEANRMCTQVCJQB-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2S |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | 5-pyrrolidin-2-ylthiophene-2-carboxylic acid;hydrochloride |
| InChIKey | IEANRMCTQVCJQB-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(S2)C(=O)O.Cl |
Computed by PubChem (NCBI)