CAS 111258-25-4 appears in our catalog under these names: Methyl 4-methoxy-1-methyl-1h-indole-2-carboxylate, 95%, Methyl 4-methoxy-1-methyl-1H-indole-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg, 5000mg.
Methyl 4-methoxy-1-methylindole-2-carboxylate (CAS 111258-25-4) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: methyl 4-methoxy-1-methylindole-2-carboxylate. InChIKey: JUWHKCSKYDXOCV-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | methyl 4-methoxy-1-methylindole-2-carboxylate |
| InChIKey | JUWHKCSKYDXOCV-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C1C(=O)OC)C(=CC=C2)OC |
Computed by PubChem (NCBI)