CAS 1113049-83-4 is the registry number for Methyl 2-amino-4-chloro-5-hydroxybenzoate hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-amino-4-chloro-5-hydroxybenzoate;hydrochloride (CAS 1113049-83-4) is a chemical compound with the molecular formula C8H9Cl2NO3 and a molecular weight of 238.06 g/mol. IUPAC name: methyl 2-amino-4-chloro-5-hydroxybenzoate;hydrochloride. InChIKey: PPISZOFSVWMIMD-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO3 |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | methyl 2-amino-4-chloro-5-hydroxybenzoate;hydrochloride |
| InChIKey | PPISZOFSVWMIMD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1N)Cl)O.Cl |
Computed by PubChem (NCBI)