Products 468721-11-1
CAS 468721-11-1 is the registry number for 2-(2-Chloro-1-iminoethyl)-1,3,5-benzenetriol Hydrochloride. Offered by: TRC. Available pack sizes: 10g, 25g, 5g.
2-(2-chloroethanimidoyl)benzene-1,3,5-triol;hydrochloride (CAS 468721-11-1) is a chemical compound with the molecular formula C8H9Cl2NO3 and a molecular weight of 238.06 g/mol. IUPAC name: 2-(2-chloroethanimidoyl)benzene-1,3,5-triol;hydrochloride. InChIKey: WXOAFVTVEKAITF-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO3 |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | 2-(2-chloroethanimidoyl)benzene-1,3,5-triol;hydrochloride |
| InChIKey | WXOAFVTVEKAITF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)C(=N)CCl)O)O.Cl |
Computed by PubChem (NCBI)