Products 2307-55-3
CAS 2307-55-3 is the registry number for Ammonium 2,4-dichlorophenoxyacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Azane;2-(2,4-dichlorophenoxy)acetic acid (CAS 2307-55-3) is a chemical compound with the molecular formula C8H9Cl2NO3 and a molecular weight of 238.06 g/mol. IUPAC name: azane;2-(2,4-dichlorophenoxy)acetic acid. InChIKey: AQKNQRMIGNOQQF-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO3 |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | azane;2-(2,4-dichlorophenoxy)acetic acid |
| InChIKey | AQKNQRMIGNOQQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)O.N |
Computed by PubChem (NCBI)
Synonyms:
azane;2-(2,4-dichlorophenoxy)acetic acid, Azanium;2-(2,4-dichlorophenoxy)acetic acid, 2,4-D-ammonium [ISO], Ammonium 2,4-D, Caswell No. 315A, EPA Pesticide Chemical Code 030005, (2,4-Dichlorophenoxy)acetic acid ammonium salt, Acetic acid, (2,4-dichlorophenoxy)-, ammonium salt, orb1698626, AQKNQRMIGNOQQF-UHFFFAOYSA-N