Products 1158281-64-1

CAS 1158281-64-1 is the registry number for Methyl 3-amino-5-chloro-2-hydroxybenzoate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Methyl 3-amino-5-chloro-2-hydroxybenzoate;hydrochloride (CAS 1158281-64-1) is a chemical compound with the molecular formula C8H9Cl2NO3 and a molecular weight of 238.06 g/mol. IUPAC name: methyl 3-amino-5-chloro-2-hydroxybenzoate;hydrochloride. InChIKey: ICPLJIAISSQWOT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9Cl2NO3
Molecular weight238.06 g/mol
IUPAC namemethyl 3-amino-5-chloro-2-hydroxybenzoate;hydrochloride
InChIKeyICPLJIAISSQWOT-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CC(=C1)Cl)N)O.Cl

Computed by PubChem (NCBI)