CAS 111454-91-2 appears in our catalog under these names: 6,8-Dimethoxyquinoline, 95%, 6,8-Dimethoxyquinoline, 95+%, 6,8-Dimethoxyquinoline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 10g, 5g, 1g, 0,5g, 50mg.
6,8-dimethoxyquinoline (CAS 111454-91-2) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 6,8-dimethoxyquinoline. InChIKey: LFTUQWJAYWMNAE-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 6,8-dimethoxyquinoline |
| InChIKey | LFTUQWJAYWMNAE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)C=CC=N2)OC |
Computed by PubChem (NCBI)