CAS 844879-54-5 is the registry number for 3-Bromo-3'-fluoro-4'-methoxybenzophenone, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(3-bromophenyl)-(3-fluoro-4-methoxyphenyl)methanone (CAS 844879-54-5) is a chemical compound with the molecular formula C14H10BrFO2 and a molecular weight of 309.13 g/mol. IUPAC name: (3-bromophenyl)-(3-fluoro-4-methoxyphenyl)methanone. InChIKey: XFBBZIQLOGYHLY-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO2 |
|---|---|
| Molecular weight | 309.13 g/mol |
| IUPAC name | (3-bromophenyl)-(3-fluoro-4-methoxyphenyl)methanone |
| InChIKey | XFBBZIQLOGYHLY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC(=CC=C2)Br)F |
Computed by PubChem (NCBI)