CAS 1114822-70-6 is the registry number for 1,4-Dimethyl-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1,4-dimethyl-2-oxo-3H-quinoline-4-carboxylic acid (CAS 1114822-70-6) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 1,4-dimethyl-2-oxo-3H-quinoline-4-carboxylic acid. InChIKey: DTFVOKBVVXNWCP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 1,4-dimethyl-2-oxo-3H-quinoline-4-carboxylic acid |
| InChIKey | DTFVOKBVVXNWCP-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)N(C2=CC=CC=C21)C)C(=O)O |
Computed by PubChem (NCBI)