CAS 1114823-93-6 is the registry number for 5-(Chlorosulfonyl)-3-methylthiophene-2-carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg, 50mg.
5-chlorosulfonyl-3-methylthiophene-2-carboxylic acid (CAS 1114823-93-6) is a chemical compound with the molecular formula C6H5ClO4S2 and a molecular weight of 240.7 g/mol. IUPAC name: 5-chlorosulfonyl-3-methylthiophene-2-carboxylic acid. InChIKey: BCZVCWODZXDDOE-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO4S2 |
|---|---|
| Molecular weight | 240.7 g/mol |
| IUPAC name | 5-chlorosulfonyl-3-methylthiophene-2-carboxylic acid |
| InChIKey | BCZVCWODZXDDOE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)