Products 175201-86-2

CAS 175201-86-2 is the registry number for 3-Chloro-4-(methylsulfonyl)thiophene-2-carboxylic acid, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-chloro-4-methylsulfonylthiophene-2-carboxylic acid (CAS 175201-86-2) is a chemical compound with the molecular formula C6H5ClO4S2 and a molecular weight of 240.7 g/mol. IUPAC name: 3-chloro-4-methylsulfonylthiophene-2-carboxylic acid. InChIKey: JHEWQNWRWAMWIV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClO4S2
Molecular weight240.7 g/mol
IUPAC name3-chloro-4-methylsulfonylthiophene-2-carboxylic acid
InChIKeyJHEWQNWRWAMWIV-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CSC(=C1Cl)C(=O)O

Computed by PubChem (NCBI)