CAS 175201-86-2 is the registry number for 3-Chloro-4-(methylsulfonyl)thiophene-2-carboxylic acid, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-4-methylsulfonylthiophene-2-carboxylic acid (CAS 175201-86-2) is a chemical compound with the molecular formula C6H5ClO4S2 and a molecular weight of 240.7 g/mol. IUPAC name: 3-chloro-4-methylsulfonylthiophene-2-carboxylic acid. InChIKey: JHEWQNWRWAMWIV-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO4S2 |
|---|---|
| Molecular weight | 240.7 g/mol |
| IUPAC name | 3-chloro-4-methylsulfonylthiophene-2-carboxylic acid |
| InChIKey | JHEWQNWRWAMWIV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CSC(=C1Cl)C(=O)O |
Computed by PubChem (NCBI)