CAS 69816-04-2 is the registry number for Methyl 5-(chlorosulfonyl)thiophene-3-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 10g.
Methyl 5-chlorosulfonylthiophene-3-carboxylate (CAS 69816-04-2) is a chemical compound with the molecular formula C6H5ClO4S2 and a molecular weight of 240.7 g/mol. IUPAC name: methyl 5-chlorosulfonylthiophene-3-carboxylate. InChIKey: IRUQLKHEXLBHKZ-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO4S2 |
|---|---|
| Molecular weight | 240.7 g/mol |
| IUPAC name | methyl 5-chlorosulfonylthiophene-3-carboxylate |
| InChIKey | IRUQLKHEXLBHKZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)