Products 869709-90-0
CAS 869709-90-0 appears in our catalog under these names: 2-(5-(Chlorosulfonyl)thiophen-2-yl)acetic acid, 97%, 2-(5-(Chlorosulfonyl)thiophen-2-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(5-chlorosulfonylthiophen-2-yl)acetic acid (CAS 869709-90-0) is a chemical compound with the molecular formula C6H5ClO4S2 and a molecular weight of 240.7 g/mol. IUPAC name: 2-(5-chlorosulfonylthiophen-2-yl)acetic acid. InChIKey: YXGUIKBJTALDPV-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO4S2 |
|---|---|
| Molecular weight | 240.7 g/mol |
| IUPAC name | 2-(5-chlorosulfonylthiophen-2-yl)acetic acid |
| InChIKey | YXGUIKBJTALDPV-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)S(=O)(=O)Cl)CC(=O)O |
Computed by PubChem (NCBI)