CAS 1114966-47-0 is the registry number for Ethyl 6-(tert-Butoxycarbonylamino)-4-chloropicolinate. Offered by: TRC. Available pack sizes: 1g.
Ethyl 4-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate (CAS 1114966-47-0) is a chemical compound with the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. IUPAC name: ethyl 4-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate. InChIKey: YJHPNKCIXPZFIS-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O4 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | ethyl 4-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate |
| InChIKey | YJHPNKCIXPZFIS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CC(=C1)Cl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)