CAS 345296-09-5 is the registry number for 1-Benzyl-APDC Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
(2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylic acid;hydrochloride (CAS 345296-09-5) is a chemical compound with the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. IUPAC name: (2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylic acid;hydrochloride. InChIKey: BDHKVJMSSDEXND-HTMVYDOJSA-N.
| Molecular formula | C13H17ClN2O4 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | (2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylic acid;hydrochloride |
| InChIKey | BDHKVJMSSDEXND-HTMVYDOJSA-N |
| SMILES | C1[C@@H](N(C[C@]1(C(=O)O)N)CC2=CC=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)