CAS 118553-99-4 appears in our catalog under these names: H-Orn(2-Cl-Z)-OH, 95%, H–Orn(2–Cl–Z)–OH, H-Orn(2-Cl-Z)-OH 95%. Offered by: AmBeed, GLPBio. Available pack sizes: 25g, 10g, 5g, 100g.
(2S)-2-amino-5-[(2-chlorophenyl)methoxycarbonylamino]pentanoic acid (CAS 118553-99-4) is a chemical compound with the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. IUPAC name: (2S)-2-amino-5-[(2-chlorophenyl)methoxycarbonylamino]pentanoic acid. InChIKey: TWPRGWUUQAAZHW-NSHDSACASA-N.
| Molecular formula | C13H17ClN2O4 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | (2S)-2-amino-5-[(2-chlorophenyl)methoxycarbonylamino]pentanoic acid |
| InChIKey | TWPRGWUUQAAZHW-NSHDSACASA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)NCCC[C@@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)