CAS 2349730-17-0 is the registry number for (S)-2-((Tert-Butoxycarbonyl)amino)-3-(4-chloropyridin-2-yl)propanoic acid. Offered by: Creative Peptides. Available pack sizes: on request.
(2S)-3-(4-chloro-2-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2349730-17-0) is a chemical compound with the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. IUPAC name: (2S)-3-(4-chloro-2-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PRLVSXCLNKYELE-JTQLQIEISA-N.
| Molecular formula | C13H17ClN2O4 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | (2S)-3-(4-chloro-2-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PRLVSXCLNKYELE-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=NC=CC(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)