Products 1117700-39-6
CAS 1117700-39-6 is the registry number for 2-[(2,4-Dimethylphenyl)formamido]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(2,4-dimethylbenzoyl)amino]propanoic acid (CAS 1117700-39-6) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 2-[(2,4-dimethylbenzoyl)amino]propanoic acid. InChIKey: SZNNWUTYNAYBQU-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-[(2,4-dimethylbenzoyl)amino]propanoic acid |
| InChIKey | SZNNWUTYNAYBQU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)NC(C)C(=O)O)C |
Computed by PubChem (NCBI)