CAS 1119195-95-7 appears in our catalog under these names: 5,5'–(Naphthalene–2,6–diyl)diisophthalic acid, 5,5'-(Naphthalene-2,6-diyl)diisophthalic acid, 98%, 98%, 5,5'-(Naphthalene-2,6-diyl)diisophthalic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
5-[6-(3,5-dicarboxyphenyl)naphthalen-2-yl]benzene-1,3-dicarboxylic acid (CAS 1119195-95-7) is a chemical compound with the molecular formula C26H16O8 and a molecular weight of 456.4 g/mol. IUPAC name: 5-[6-(3,5-dicarboxyphenyl)naphthalen-2-yl]benzene-1,3-dicarboxylic acid. InChIKey: CYKPOGLPCGBVSQ-UHFFFAOYSA-N.
| Molecular formula | C26H16O8 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | 5-[6-(3,5-dicarboxyphenyl)naphthalen-2-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | CYKPOGLPCGBVSQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C=C1C4=CC(=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)