CAS 1119196-01-8 appears in our catalog under these names: 5,5'-(Naphthalene-1,4-diyl)diisophthalic acid, 95%, 95%, 5,5'-(Naphthalene-1,4-diyl)diisophthalic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
5-[4-(3,5-dicarboxyphenyl)naphthalen-1-yl]benzene-1,3-dicarboxylic acid (CAS 1119196-01-8) is a chemical compound with the molecular formula C26H16O8 and a molecular weight of 456.4 g/mol. IUPAC name: 5-[4-(3,5-dicarboxyphenyl)naphthalen-1-yl]benzene-1,3-dicarboxylic acid. InChIKey: NIZXUKQACFYXHJ-UHFFFAOYSA-N.
| Molecular formula | C26H16O8 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | 5-[4-(3,5-dicarboxyphenyl)naphthalen-1-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | NIZXUKQACFYXHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C3=CC(=CC(=C3)C(=O)O)C(=O)O)C4=CC(=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)