CAS 1426343-45-4 appears in our catalog under these names: 5,5'-(Naphthalene-2,7-diyl)diisophthalic acid, 95%, 95%, 5,5'-(Naphthalene-2,7-diyl)di(isophthalic acid), 95%, 5,5'-(Naphthalene-2,7-diyl)diisophthalic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-[7-(3,5-dicarboxyphenyl)naphthalen-2-yl]benzene-1,3-dicarboxylic acid (CAS 1426343-45-4) is a chemical compound with the molecular formula C26H16O8 and a molecular weight of 456.4 g/mol. IUPAC name: 5-[7-(3,5-dicarboxyphenyl)naphthalen-2-yl]benzene-1,3-dicarboxylic acid. InChIKey: OHXZIXBBRUEXSJ-UHFFFAOYSA-N.
| Molecular formula | C26H16O8 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | 5-[7-(3,5-dicarboxyphenyl)naphthalen-2-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | OHXZIXBBRUEXSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C4=CC(=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)