CAS 1895077-69-6 appears in our catalog under these names: 5,5'–(Naphthalene–1,5–diyl)diisophthalicacid, 5,5'-(Naphthalene-1,5-diyl)diisophthalic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg, 250mg.
5-[5-(3,5-dicarboxyphenyl)naphthalen-1-yl]benzene-1,3-dicarboxylic acid (CAS 1895077-69-6) is a chemical compound with the molecular formula C26H16O8 and a molecular weight of 456.4 g/mol. IUPAC name: 5-[5-(3,5-dicarboxyphenyl)naphthalen-1-yl]benzene-1,3-dicarboxylic acid. InChIKey: YPGWWACOIFPAKG-UHFFFAOYSA-N.
| Molecular formula | C26H16O8 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | 5-[5-(3,5-dicarboxyphenyl)naphthalen-1-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | YPGWWACOIFPAKG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2C3=CC(=CC(=C3)C(=O)O)C(=O)O)C(=C1)C4=CC(=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)