CAS 1119390-49-6 is the registry number for N-(5-Amino-2,4-dichlorophenyl)-4-methylbenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(5-amino-2,4-dichlorophenyl)-4-methylbenzenesulfonamide (CAS 1119390-49-6) is a chemical compound with the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.2 g/mol. IUPAC name: N-(5-amino-2,4-dichlorophenyl)-4-methylbenzenesulfonamide. InChIKey: USVABAQCWHPPMJ-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O2S |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | N-(5-amino-2,4-dichlorophenyl)-4-methylbenzenesulfonamide |
| InChIKey | USVABAQCWHPPMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C(=C2)N)Cl)Cl |
Computed by PubChem (NCBI)