CAS 500194-61-6 is the registry number for Ethyl 3-((2,4-dichlorophenyl)amino)-5-methyl-2,4-thiazolecarboxylate. Offered by: Biosynth. Available pack sizes: 25g, 10g.
Ethyl 2-(2,4-dichloroanilino)-4-methyl-1,3-thiazole-5-carboxylate (CAS 500194-61-6) is a chemical compound with the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.2 g/mol. IUPAC name: ethyl 2-(2,4-dichloroanilino)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: VLRQPIOQXKNABY-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O2S |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | ethyl 2-(2,4-dichloroanilino)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | VLRQPIOQXKNABY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)NC2=C(C=C(C=C2)Cl)Cl)C |
Computed by PubChem (NCBI)