Products 1498656-13-5

CAS 1498656-13-5 is the registry number for Ethyl 2-(4-(3,4-dichlorophenylamino)-3,5-thiazolyl)acetate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]acetate (CAS 1498656-13-5) is a chemical compound with the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.2 g/mol. IUPAC name: ethyl 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]acetate. InChIKey: AYYAIYXXIZZDQT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12Cl2N2O2S
Molecular weight331.2 g/mol
IUPAC nameethyl 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]acetate
InChIKeyAYYAIYXXIZZDQT-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CSC(=N1)NC2=CC(=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)