CAS 1493430-96-8 is the registry number for Ethyl 2-(4-(3,5-dichlorophenylamino)-3,5-thiazolyl)acetate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
Ethyl 2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetate (CAS 1493430-96-8) is a chemical compound with the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.2 g/mol. IUPAC name: ethyl 2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetate. InChIKey: PPNDDNIRBQPQRF-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O2S |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | ethyl 2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetate |
| InChIKey | PPNDDNIRBQPQRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CSC(=N1)NC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)